cas: 1349807-46-0 — see every product listed under this CAS number, including other names
FMoc-N-me-d-cys(trt)-oh, 98% HPLC(contains~10.0% solvent), 98% HPLC(contains~10.0% solvent) (CAS 1349807-46-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110I6D-5g |
| cas | 1349807-46-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2008.40 Pln | |
| Chemat | 100g | 21242.00 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 25g | 6678.80 Pln |
| purity | 98% HPLC(contains~10.0% solvent) |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid (CAS 1349807-46-0) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid. InChIKey: RAKOPMQMPUNRGI-PGUFJCEWSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid |
| InChIKey | RAKOPMQMPUNRGI-PGUFJCEWSA-N |
| SMILES | CN([C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)