CAS 599151-35-6 appears in our catalog under these names: FQI 1/ 98.69% (existing batch purity), FQI 1, FQI1, FQI1 99%, 8-(2-Ethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]quinolin-6(5H)-one. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
8-(2-ethoxyphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (CAS 599151-35-6) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 8-(2-ethoxyphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one. InChIKey: YKSYGLXHLSPWLB-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 8-(2-ethoxyphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| InChIKey | YKSYGLXHLSPWLB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1C2CC(=O)NC3=CC4=C(C=C23)OCO4 |
Computed by PubChem (NCBI)