cas: 1033622-38-6 — see every product listed under this CAS number, including other names
Fmoc–N–(propargyl)–glycine (CAS 1033622-38-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13671-1g |
| cas | 1033622-38-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1280.39 Pln | |
| GLPBio | 250mg | 723.41 Pln | |
| GLPBio | 50mg | 522.15 Pln | |
| GLPBio | 5g | 3307.05 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-ynyl)amino]acetic acid (CAS 1033622-38-6) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-ynyl)amino]acetic acid. InChIKey: BTHZEMFPZILBCR-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-ynyl)amino]acetic acid |
| InChIKey | BTHZEMFPZILBCR-UHFFFAOYSA-N |
| SMILES | C#CCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)