cas: 1198791-58-0 — see every product listed under this CAS number, including other names
Fmoc-α-Me-Gly(Propargyl)-OH 98% (CAS 1198791-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A798661-100mg |
| cas | 1198791-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1532.94 Pln | |
| Ambeed | 5g | 5621.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A798661 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid (CAS 1198791-58-0) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid. InChIKey: ZXOKSWZUJXKQCQ-NRFANRHFSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-ynoic acid |
| InChIKey | ZXOKSWZUJXKQCQ-NRFANRHFSA-N |
| SMILES | C[C@](CC#C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)