Fmoc-β-HoAsp(OtBu)-OH 98%
cas: 209252-17-5 — see every product listed under this CAS number, including other names
Fmoc-β-HoAsp(OtBu)-OH 98% (CAS 209252-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106179-100g |
| cas | 209252-17-5 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 12624.56 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 3991.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A106179 |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 209252-17-5) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: XXXSUGLINJXRGT-OAHLLOKOSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | XXXSUGLINJXRGT-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)