Products 172846-53-6
CAS 172846-53-6 is the registry number for 4-tert-butyl 1-methyl (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-O-tert-butyl 1-O-methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate (CAS 172846-53-6) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate. InChIKey: BLPQLKOUQCRNET-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
| InChIKey | BLPQLKOUQCRNET-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)