CAS 123417-18-5 appears in our catalog under these names: Boc-L-Glutamic acid 5-fluorenylmethylester, ≥95%, Boc-glu(ofm)-oh, 96%, Boc–Glu(Ofm)–OH, Boc-glu(OFm)-OH, Boc-Glu(Ofm)-OH 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 50g, 250g, 500g.
(2S)-5-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 123417-18-5) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (2S)-5-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: RCQRXYWDDVULAP-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (2S)-5-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | RCQRXYWDDVULAP-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)