CAS 209252-17-5 appears in our catalog under these names: Fmoc-L-beta-glutamic acid 5-tert-butyl ester, 98%, Fmoc– ?–HoAsp(OtBu)–OH, N-Fmoc-L-beta-glutamic acid 5-tert-butyl ester, 95% , Fmoc-β-HoAsp(OtBu)-OH 98%, Fmoc-β-HoAsp(OtBu)-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100g, 25g, 100mg, 10g, 5 g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 209252-17-5) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: XXXSUGLINJXRGT-OAHLLOKOSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | XXXSUGLINJXRGT-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)