Fmoc-β-HoAsp(OtBu)-OH, 99.85%
cas: 209252-17-5 — see every product listed under this CAS number, including other names
Fmoc-β-HoAsp(OtBu)-OH, 99.85% (CAS 209252-17-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W010924-5 g |
| cas | 209252-17-5 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1104.53 Pln | |
| MedChemExpress | 1 g | 407.93 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.85% |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 209252-17-5) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: XXXSUGLINJXRGT-OAHLLOKOSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | XXXSUGLINJXRGT-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)