Fmoc-1-amino-cyclohexane acetic acid 95%
cas: 282524-98-5 — see every product listed under this CAS number, including other names
Fmoc-1-amino-cyclohexane acetic acid 95% (CAS 282524-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A234046-100mg |
| cas | 282524-98-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 859.88 Pln | |
| Ambeed | 5g | 2840.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A234046 |
2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid (CAS 282524-98-5) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid. InChIKey: XAUDVWHRZVURNT-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid |
| InChIKey | XAUDVWHRZVURNT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-1-amino-cyclohexane acetic acid, (1-Fmoc-aminocyclohexyl)acetic acid, N-Fmoc-2-(1-aminocyclohexyl)acetic acid, (1-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclohexyl)acetic acid, 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid, 1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclohexaneacetic acid, 2-(1-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)cyclohexyl)acetic acid, (Fmoc-NH-cyclohexyl)acetic acid, Fmoc-beta-3,3-Ac6c-OH, Fmoc-1-amino-cyclohexaneaceticacid