cas: 371770-32-0 — see every product listed under this CAS number, including other names
Fmoc-Cpa-OH, 99.88% (CAS 371770-32-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W041983-5 g |
| cas | 371770-32-0 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1392.46 Pln | |
| MedChemExpress | 1 g | 394.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.88% |
(2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 371770-32-0) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NVZVRXJTMCMDNR-NRFANRHFSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NVZVRXJTMCMDNR-NRFANRHFSA-N |
| SMILES | C1CCC(C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)