CAS 371770-32-0 appears in our catalog under these names: Fmoc–Cpa–OH, Fmoc-L-cycPentAla-OH, (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid, 97%, 97%, Fmoc-Cpa-OH, 99.88%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyclopentylpropanoic acid, 95%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 10g, 25g.
(2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 371770-32-0) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NVZVRXJTMCMDNR-NRFANRHFSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NVZVRXJTMCMDNR-NRFANRHFSA-N |
| SMILES | C1CCC(C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)