CAS 189937-46-0 appears in our catalog under these names: Fmoc-D-3,3-diphenylalanine, 97%, Fmoc–D–3,3–diphenylalanine, Fmoc-D-Dip-OH, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-diphenylpropanoic acid, 98%, 98%, Fmoc-D-3,3-diphenylalanine, 99.90%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg, 5 g, 10 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-diphenylpropanoic acid (CAS 189937-46-0) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-diphenylpropanoic acid. InChIKey: PENQOTJCVODUQU-MUUNZHRXSA-N.
| Molecular formula | C30H25NO4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-diphenylpropanoic acid |
| InChIKey | PENQOTJCVODUQU-MUUNZHRXSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)