Products 1014019-74-9
CAS 1014019-74-9 is the registry number for Fmoc-cis-4-(Nap-2-yl)-Pro-OH 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-naphthalen-2-ylpyrrolidine-2-carboxylic acid (CAS 1014019-74-9) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-naphthalen-2-ylpyrrolidine-2-carboxylic acid. InChIKey: BIHLSQSGROVWLJ-DWACAAAGSA-N.
| Molecular formula | C30H25NO4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-naphthalen-2-ylpyrrolidine-2-carboxylic acid |
| InChIKey | BIHLSQSGROVWLJ-DWACAAAGSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=CC6=CC=CC=C6C=C5 |
Computed by PubChem (NCBI)