CAS 1260602-10-5 appears in our catalog under these names: Fmoc-D-Phe(3-Ph)-OH 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-([1,1'-biphenyl]-3-yl)propanoic acid, ≥95%, ≥95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylphenyl)propanoic acid (CAS 1260602-10-5) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylphenyl)propanoic acid. InChIKey: YOUSZFJTJZGJIK-MUUNZHRXSA-N.
| Molecular formula | C30H25NO4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylphenyl)propanoic acid |
| InChIKey | YOUSZFJTJZGJIK-MUUNZHRXSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)