Products 1260613-67-9
CAS 1260613-67-9 is the registry number for (3S)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-(4-phenylphenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid (CAS 1260613-67-9) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid. InChIKey: PEYWNXMITXNNRZ-NDEPHWFRSA-N.
| Molecular formula | C30H25NO4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid |
| InChIKey | PEYWNXMITXNNRZ-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)