Products 2352070-31-4

CAS 2352070-31-4 is the registry number for 2-N-Fmoc-3-([1,1'-biphenyl]-2-yl)propanoic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-phenylphenyl)propanoic acid (CAS 2352070-31-4) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-phenylphenyl)propanoic acid. InChIKey: LVWTWJBBUVERRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC30H25NO4
Molecular weight463.5 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-phenylphenyl)propanoic acid
InChIKeyLVWTWJBBUVERRZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=CC=C2CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35

Computed by PubChem (NCBI)