Fmoc-D-Phe-OH 98%
cas: 86123-10-6 — see every product listed under this CAS number, including other names
Fmoc-D-Phe-OH 98% (CAS 86123-10-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148507-5g |
| cas | 86123-10-6 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 659.62 Pln | |
| Ambeed | 1000g | 1249.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148507 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 86123-10-6) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-JOCHJYFZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | SJVFAHZPLIXNDH-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid, (2R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylpropanoic acid, Fmoc-D-Phe-OH, Fmoc-D-phenylalanine, D-Fmoc-Phenylalanine, N-Fmoc-D-phenylalanine, (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid, D-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylpropanoic acid, (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-phenylalanine