Products 125700-32-5
CAS 125700-32-5 appears in our catalog under these names: Fmoc-(15N)Phe-OH, Fmoc-Phe-OH-15N. Offered by: Creative Peptides, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 50 mg, 10 mg, 100 mg, 5 mg, 25 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-phenylpropanoic acid (CAS 125700-32-5) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 388.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-LJSUXKQBSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-phenylpropanoic acid |
| InChIKey | SJVFAHZPLIXNDH-LJSUXKQBSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)[15NH]C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)