Products 100750-05-8

CAS 100750-05-8 is the registry number for Fmoc-dl-phe-oh, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 500g, 25g, 100g, 10g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 100750-05-8) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO4
Molecular weight387.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid
InChIKeySJVFAHZPLIXNDH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)