CAS 35661-40-6 appears in our catalog under these names: Fmoc–Phe–OH, Fmoc-L-Phe-OH, Fmoc-Phe-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine, >98.0%(HPLC)(T), Fmoc-Phe-OH, 99.00%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Chemat. Available pack sizes: 100g, 25g, 500g, 250g, 0,5kg, 0,25kg, 5g, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 35661-40-6) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-QFIPXVFZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | SJVFAHZPLIXNDH-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)