CAS 1353853-39-0 appears in our catalog under these names: N-FMOC-L-phenylalanine-d8, L-Phenyl-d5-alanine-2,3,3-d3-N-FMOC, 98 atom % D, min 98% Chemical Purity, Fmoc-Phe-OH-d8, 98.46%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 10 mg, 50 mg, 5 mg, 25 mg.
(2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 1353853-39-0) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 395.5 g/mol. IUPAC name: (2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: SJVFAHZPLIXNDH-PLPXMBJESA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | (2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | SJVFAHZPLIXNDH-PLPXMBJESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[2H])[2H] |
Computed by PubChem (NCBI)