cas: 86123-11-7 — see every product listed under this CAS number, including other names
Fmoc-D-Trp-OH, 99% (CAS 86123-11-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A110273-5g |
| cas | 86123-11-7 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 325.88 Pln | |
| Ambeed | 500g | 1332.69 Pln | |
| Ambeed | 1kg | 2094.75 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 342.13 Pln | |
| BLDpharm | 500g | 1436.19 Pln | |
| BLDpharm | 1kg | 2252.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 86123-11-7) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: MGHMWKZOLAAOTD-XMMPIXPASA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | MGHMWKZOLAAOTD-XMMPIXPASA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=CC=CC=C54)C(=O)O |
Computed by PubChem (NCBI)