CAS 2855087-10-2 is the registry number for CDK8-IN-5. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
5-hydroxy-2-phenyl-7-[4-(piperazine-1-carbonyl)phenyl]chromen-4-one (CAS 2855087-10-2) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: 5-hydroxy-2-phenyl-7-[4-(piperazine-1-carbonyl)phenyl]chromen-4-one. InChIKey: MVNMSJKQMNWECK-UHFFFAOYSA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 5-hydroxy-2-phenyl-7-[4-(piperazine-1-carbonyl)phenyl]chromen-4-one |
| InChIKey | MVNMSJKQMNWECK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)C3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)