CAS 35737-15-6 appears in our catalog under these names: Fmoc–Trp–OH, Fmoc-L-Trp-OH, Fmoc-Trp-OH, 98.00%, Nalpha-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tryptophan, >98.0%(HPLC)(T), Fmoc-Trp-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Biosynth, TCI. Available pack sizes: 100g, 25g, 5g, 0,25kg, 0,5kg, 1kg, 2kg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 35737-15-6) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: MGHMWKZOLAAOTD-DEOSSOPVSA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | MGHMWKZOLAAOTD-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=CC=CC=C54)C(=O)O |
Computed by PubChem (NCBI)