CAS 86123-11-7 appears in our catalog under these names: Fmoc-D-Trp-OH, Nalpha-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-tryptophan, >97.0%(HPLC)(T), Fmoc-D-Trp-OH, 97%, 97%, Fmoc-D-Trp-OH, 99.98%, Fmoc-D-Trp-OH, 97%. Offered by: Iris Biotech, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 10g, 100g, 500g, 1kg, 10mM/1mL, 25 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 86123-11-7) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: MGHMWKZOLAAOTD-XMMPIXPASA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | MGHMWKZOLAAOTD-XMMPIXPASA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=CC=CC=C54)C(=O)O |
Computed by PubChem (NCBI)