CAS 269726-84-3 appears in our catalog under these names: Fmoc-(r)-3-amino-4-(3-cyano-phenyl)-butyric acid, 95%, Fmoc-(R)-3-Amino-4-(3-cyano-phenyl)-butyric acid, 98%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-cyanophenyl)butanoic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg.
(3R)-4-(3-cyanophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 269726-84-3) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: (3R)-4-(3-cyanophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: JCMKWCSZEZUIQG-LJQANCHMSA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (3R)-4-(3-cyanophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | JCMKWCSZEZUIQG-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)C#N)CC(=O)O |
Computed by PubChem (NCBI)