cas: 215178-46-4 — see every product listed under this CAS number, including other names
Fmoc-D-valinol 97% (CAS 215178-46-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109109-25g |
| cas | 215178-46-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 1388.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109109 |
9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate (CAS 215178-46-4) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate. InChIKey: MYMGENAMKAPEMT-IBGZPJMESA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| InChIKey | MYMGENAMKAPEMT-IBGZPJMESA-N |
| SMILES | CC(C)[C@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)