cas: 1599440-06-8 — see every product listed under this CAS number, including other names
Fmoc-Gly-NH-CH2-acetyloxy 95% (CAS 1599440-06-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1189995-100mg |
| cas | 1599440-06-8 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1277.06 Pln | |
| Ambeed | 25g | 2428.50 Pln | |
| Ambeed | 100g | 5159.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1189995 |
[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methyl acetate (CAS 1599440-06-8) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methyl acetate. InChIKey: NKDSPEFADHLMHN-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methyl acetate |
| InChIKey | NKDSPEFADHLMHN-UHFFFAOYSA-N |
| SMILES | CC(=O)OCNC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)