CAS 288149-55-3 appears in our catalog under these names: (S)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-amino-5-oxopentanoic acid, 97%, (S)–4–((((9H–fluoren–9–yl)methoxy)carbonyl)amino)–5–amino–5–oxopentanoic acid, Fmoc–Glu–NH₂, Fmoc-L-Glu-NH2, Fmoc-L-isoGln-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 100g, 10g.
(4S)-5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (CAS 288149-55-3) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (4S)-5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid. InChIKey: MZRFDZFXTSDMFA-KRWDZBQOSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (4S)-5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
| InChIKey | MZRFDZFXTSDMFA-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)