CAS 283160-18-9 appears in our catalog under these names: N-Beta-fmoc-l-beta-glutamine, 95%, Fmoc–L–β–Homoasparagine, N-Beta-fmoc-l-beta-glutamine, 95%, 95%, (S)-4-Carbamoyl-3-(9H-fluoren-9-ylmethoxycarbonyl-amino)-butyric acid, 97%, Fmoc-β-Gln-OH, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3S)-5-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (CAS 283160-18-9) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (3S)-5-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid. InChIKey: ANJWRJHJFIBTBO-LBPRGKRZSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (3S)-5-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
| InChIKey | ANJWRJHJFIBTBO-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)