CAS 181952-29-4 appears in our catalog under these names: Fmoc-Dap(Ac)-OH, Fmoc-Dap(Ac)-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-acetamidopropanoic acid, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-acetamidopropanoic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 50g, 100mg, 250mg, 1g.
(2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181952-29-4) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NJHKPVSGTKWJEN-SFHVURJKSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NJHKPVSGTKWJEN-SFHVURJKSA-N |
| SMILES | CC(=O)NC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)