CAS 157355-74-3 is the registry number for Fmoc-DL-Gln-OH, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (CAS 157355-74-3) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: 5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid. InChIKey: IZKGGDFLLNVXNZ-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
| InChIKey | IZKGGDFLLNVXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)