Products 157355-74-3

CAS 157355-74-3 is the registry number for Fmoc-DL-Gln-OH, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid (CAS 157355-74-3) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: 5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid. InChIKey: IZKGGDFLLNVXNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20N2O5
Molecular weight368.4 g/mol
IUPAC name5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid
InChIKeyIZKGGDFLLNVXNZ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(=O)N)C(=O)O

Computed by PubChem (NCBI)