cas: 122996-47-8 — see every product listed under this CAS number, including other names
Fmoc-Hyp(tBu)-OH, 97% HPLC (CAS 122996-47-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A265743-1g |
| cas | 122996-47-8 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 314.75 Pln | |
| Ambeed | 100g | 1021.19 Pln | |
| Ambeed | 500g | 4803.69 Pln | |
| Ambeed | 1kg | 9109.06 Pln |
| purity | 97% HPLC |
|---|---|
| delivery time | 1-2 weeks |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid (CAS 122996-47-8) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid. InChIKey: WPBXBYOKQUEIDW-VFNWGFHPSA-N.
| Molecular formula | C24H27NO5 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid |
| InChIKey | WPBXBYOKQUEIDW-VFNWGFHPSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)