cas: 122996-47-8 — see every product listed under this CAS number, including other names
Fmoc-Hyp(tBu)-OH, 98%, 98% (CAS 122996-47-8) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 10kg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JVO-5kg |
| cas | 122996-47-8 |
| size | 5kg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 21878.40 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 50g | 400.40 Pln | |
| Chemat | 250g | 1739.60 Pln | |
| Chemat | 500g | 3475.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid (CAS 122996-47-8) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid. InChIKey: WPBXBYOKQUEIDW-VFNWGFHPSA-N.
| Molecular formula | C24H27NO5 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid |
| InChIKey | WPBXBYOKQUEIDW-VFNWGFHPSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)