cas: 199110-64-0 — see every product listed under this CAS number, including other names
Fmoc-L-4,4'-Biphenylalanine, 98%, 98% (CAS 199110-64-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 500g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BWM-100g |
| cas | 199110-64-0 |
| size | 100g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 3093.20 Pln | |
| Chemat | 250g | 6328.40 Pln | |
| Chemat | 500g | 11937.60 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 842.00 Pln | |
| Chemat | 50g | 1590.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid (CAS 199110-64-0) is a chemical compound with the molecular formula C30H25NO4 and a molecular weight of 463.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid. InChIKey: VSGACONKQRJFGX-NDEPHWFRSA-N.
| Molecular formula | C30H25NO4 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylphenyl)propanoic acid |
| InChIKey | VSGACONKQRJFGX-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)