cas: 71989-26-9 — see every product listed under this CAS number, including other names
Fmoc-L-Lys (Boc)-OH, 99.98% (CAS 71989-26-9) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 1 g, 100 g, 500 g, 50 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-79128-25 g |
| cas | 71989-26-9 |
| size | 25 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 551.89 Pln | |
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 100 g | 751.58 Pln | |
| MedChemExpress | 500 g | 1225.27 Pln | |
| MedChemExpress | 50 g | 649.42 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 10 g | 407.93 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.98% |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 71989-26-9) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: UMRUUWFGLGNQLI-UHFFFAOYSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | UMRUUWFGLGNQLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)