cas: 71989-26-9 — see every product listed under this CAS number, including other names
Fmoc-Lys(Boc)-OH, 98% (CAS 71989-26-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 100g, 250g, 500g, 1kg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1146C5-25g |
| cas | 71989-26-9 |
| size | 25g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 98.00 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 232.23 Pln | |
| Fluorochem | 250g | 487.35 Pln | |
| Fluorochem | 500g | 914.28 Pln | |
| Fluorochem | 1kg | 1742.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 71989-26-9) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: UMRUUWFGLGNQLI-UHFFFAOYSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | UMRUUWFGLGNQLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)