cas: 198561-07-8 — see every product listed under this CAS number, including other names
Fmoc-L-propargylglycine, 97% (CAS 198561-07-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 5g, 1g, 25g, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-2360-10g |
| cas | 198561-07-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 883.04 Pln | |
| Fluorochem | 100g | 3267.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 198561-07-8) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)