cas: 159766-56-0 — see every product listed under this CAS number, including other names
Fmoc-Lys(Ac)-OH, 98%, 98% (CAS 159766-56-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RDC-1g |
| cas | 159766-56-0 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 1499.60 Pln | |
| Chemat | 5kg | 7108.80 Pln | |
| Chemat | 50g | 275.60 Pln | |
| Chemat | 250g | 818.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 159766-56-0) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: (2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: HQLBYVWJOXITAM-NRFANRHFSA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | HQLBYVWJOXITAM-NRFANRHFSA-N |
| SMILES | CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)