Products 142810-18-2
CAS 142810-18-2 appears in our catalog under these names: 2-((2S,3S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylpentanamido)acetic acid, 95%, 95%, Fmoc-Ile-Gly-OH, Fmoc–Ile–Gly–OH, Fmoc-L-Ile-Gly-OH, Fmoc-L-Ile-Gly-OH 95%. Offered by: Chemat, Creative Peptides, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 5000mg, 2000mg, 10000mg.
2-[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]acetic acid (CAS 142810-18-2) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: 2-[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]acetic acid. InChIKey: BVPMIIMLKAWZFO-QKKBWIMNSA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 2-[[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]amino]acetic acid |
| InChIKey | BVPMIIMLKAWZFO-QKKBWIMNSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)