CAS 139881-77-9 appears in our catalog under these names: Fmoc-Aib-Aib-OH, 2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanamido)-2-methylpropanoic acid, 98%, Fmoc-Aib-Aib-OH 98%, Fmoc-Aib-Aib-OH, 98%, 98%, Fmoc-Aib-Aib-OH, 98%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 500mg, 5g, 100mg, 250mg, 1g.
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]amino]-2-methylpropanoic acid (CAS 139881-77-9) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]amino]-2-methylpropanoic acid. InChIKey: RVZDLBMKWJAFHK-UHFFFAOYSA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoyl]amino]-2-methylpropanoic acid |
| InChIKey | RVZDLBMKWJAFHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC(C)(C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)