CAS 150114-97-9 appears in our catalog under these names: Fmoc-Val-Ala-OH, 97%, Fmoc–Val–Ala–OH, FMOC-VAL-ALA-OH, (((9H-Fluoren-9-yl)methoxy)carbonyl)-L-valyl-L-alanine, 98%, 98%, Fmoc-Val-Ala-OH, 99.85%. Offered by: Ambeed, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg.
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid (CAS 150114-97-9) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid. InChIKey: KQZMZNLKVKGMJS-XOBRGWDASA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | KQZMZNLKVKGMJS-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)