CAS 139928-72-6 appears in our catalog under these names: Fmoc-B-Ala-Val-OH, Fmoc-L-alanyl-L-valine, 98%. Offered by: TRC, Ambeed. Available pack sizes: 50mg, 250mg, 1g.
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-3-methylbutanoic acid (CAS 139928-72-6) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-3-methylbutanoic acid. InChIKey: CVUPNZGFKNTZNW-XOBRGWDASA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-3-methylbutanoic acid |
| InChIKey | CVUPNZGFKNTZNW-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)