Fmoc-Lys(N3)-OH, 95%
cas: 159610-89-6 — see every product listed under this CAS number, including other names
Fmoc-Lys(N3)-OH, 95% (CAS 159610-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F494322-100MG |
| cas | 159610-89-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 117.68 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1023.62 Pln | |
| Fluorochem | 10g | 1388.07 Pln | |
| Fluorochem | 25g | 2694.90 Pln | |
| Fluorochem | 100g | 8484.53 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 2128.12 Pln | |
| Ambeed | 10g | 4180.69 Pln | |
| Ambeed | 25g | 10343.94 Pln | |
| Ambeed | 100g | 20178.44 Pln |
properties
| purity | 95,00% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 159610-89-6) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PJRFTUILPGJJIO-IBGZPJMESA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PJRFTUILPGJJIO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid, (2S)-6-azido-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid, Fmoc-Lys(N3)-OH, Fmoc-L-azidolysine, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-azidohexanoic acid, 6-Azido-N-Fmoc-L-norleucine, (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid, N6-Diazo-L-Fmoc-lysine, Fmoc-L-Lys(N3)-OH, 6-Azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-norleucine