CAS 1198791-53-5 appears in our catalog under these names: Fmoc–D–Lys(N3)–OH, Fmoc-D-Lys(N3)-OH, (2R)-6-Azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid, Fmoc-D-Lys(N3)-OH 95%, Fmoc-D-Lys(N3)-OH, 99.49%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1g, 5g, 25g, 0,1g.
(2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1198791-53-5) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PJRFTUILPGJJIO-LJQANCHMSA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PJRFTUILPGJJIO-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)