CAS 159610-89-6 appears in our catalog under these names: Fmoc-L-azidolysine, 97%, Fmoc–ε–azido–Nle–OH, Fmoc-L-Lys(N3)-OH, Fmoc-Azido-Lys-OH, Fmoc-Lys(N3)-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 25g, 5g, 10g, 250mg, 1g, 100mg, 25mg, 50mg.
(2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 159610-89-6) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PJRFTUILPGJJIO-IBGZPJMESA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PJRFTUILPGJJIO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)