Products 2991255-09-3
CAS 2991255-09-3 appears in our catalog under these names: Fmoc-L-MeOrn(N3)-OH, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-5-azidopentanoic acid, 95%, 95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2S)-5-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid (CAS 2991255-09-3) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-5-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid. InChIKey: XHSXBLZJVFKSNE-IBGZPJMESA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-5-azido-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid |
| InChIKey | XHSXBLZJVFKSNE-IBGZPJMESA-N |
| SMILES | CN([C@@H](CCCN=[N+]=[N-])C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)