CAS 473430-12-5 is the registry number for N3-L-Lys(Fmoc)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 500mg, Get quote.
(2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 473430-12-5) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: QETYFSMTHHMLJP-IBGZPJMESA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-2-azido-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | QETYFSMTHHMLJP-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)