cas: 139262-23-0 — see every product listed under this CAS number, including other names
Fmoc-Lys-OH·HCl 98% (CAS 139262-23-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146292-1g |
| cas | 139262-23-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 570.62 Pln | |
| Ambeed | 500g | 2578.69 Pln | |
| Ambeed | 1000g | 4336.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146292 |
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride (CAS 139262-23-0) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride. InChIKey: MVMZFAIUUXYFGY-FYZYNONXSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
| InChIKey | MVMZFAIUUXYFGY-FYZYNONXSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)